C10H15NO2S — CID 5028412
2,3,5,6-tetramethylbenzenesulfonamide (PubChem CID 5028412) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is 2,3,5,6-tetramethylbenzenesulfonamide.
| Compound Name | 2,3,5,6-tetramethylbenzenesulfonamide |
|---|---|
| PubChem CID | 5028412 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 2,3,5,6-tetramethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(C)c(S(N)(=O)=O)c1C |
| InChI | InChI=1S/C10H15NO2S/c1-6-5-7(2)9(4)10(8(6)3)14(11,12)13/h5H,1-4H3,(H2,11,12,13) |
| InChIKey | WOTPIPCWLVBYSQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |