C12H17NO4S — CID 63839844
ethyl 2,4,6-trimethyl-3-sulfamoylbenzoate (PubChem CID 63839844) has the molecular formula C12H17NO4S and a molecular weight of 271.34 g/mol. Its IUPAC name is ethyl 2,4,6-trimethyl-3-sulfamoylbenzoate.
| Compound Name | ethyl 2,4,6-trimethyl-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 63839844 |
| Molecular Formula | C12H17NO4S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | ethyl 2,4,6-trimethyl-3-sulfamoylbenzoate |
| SMILES | CCOC(=O)c1c(C)cc(C)c(S(N)(=O)=O)c1C |
| InChI | InChI=1S/C12H17NO4S/c1-5-17-12(14)10-7(2)6-8(3)11(9(10)4)18(13,15)16/h6H,5H2,1-4H3,(H2,13,15,16) |
| InChIKey | PTBJCPXNDGOGHN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |