C13H20N2O3S — CID 65375039
N-ethyl-N,2,4,6-tetramethyl-3-sulfamoylbenzamide (PubChem CID 65375039) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is N-ethyl-N,2,4,6-tetramethyl-3-sulfamoylbenzamide.
| Compound Name | N-ethyl-N,2,4,6-tetramethyl-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65375039 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | N-ethyl-N,2,4,6-tetramethyl-3-sulfamoylbenzamide |
| SMILES | CCN(C)C(=O)c1c(C)cc(C)c(S(N)(=O)=O)c1C |
| InChI | InChI=1S/C13H20N2O3S/c1-6-15(5)13(16)11-8(2)7-9(3)12(10(11)4)19(14,17)18/h7H,6H2,1-5H3,(H2,14,17,18) |
| InChIKey | OHAZYSNROPTQKT-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |