C13H17NO5S — CID 102608695
oxetan-3-yl 2,4,6-trimethyl-3-sulfamoylbenzoate (PubChem CID 102608695) has the molecular formula C13H17NO5S and a molecular weight of 299.35 g/mol. Its IUPAC name is oxetan-3-yl 2,4,6-trimethyl-3-sulfamoylbenzoate.
| Compound Name | oxetan-3-yl 2,4,6-trimethyl-3-sulfamoylbenzoate |
|---|---|
| PubChem CID | 102608695 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | oxetan-3-yl 2,4,6-trimethyl-3-sulfamoylbenzoate |
| SMILES | Cc1cc(C)c(S(N)(=O)=O)c(C)c1C(=O)OC1COC1 |
| InChI | InChI=1S/C13H17NO5S/c1-7-4-8(2)12(20(14,16)17)9(3)11(7)13(15)19-10-5-18-6-10/h4,10H,5-6H2,1-3H3,(H2,14,16,17) |
| InChIKey | PCMHTEFIFBIPAN-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |