C9H9ClO5S2 — CID 102608574
oxetan-3-yl 4-chlorosulfonyl-5-methylthiophene-2-carboxylate (PubChem CID 102608574) has the molecular formula C9H9ClO5S2 and a molecular weight of 296.75 g/mol. Its IUPAC name is oxetan-3-yl 4-chlorosulfonyl-5-methylthiophene-2-carboxylate.
| Compound Name | oxetan-3-yl 4-chlorosulfonyl-5-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 102608574 |
| Molecular Formula | C9H9ClO5S2 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 295.96 |
| IUPAC Name | oxetan-3-yl 4-chlorosulfonyl-5-methylthiophene-2-carboxylate |
| SMILES | Cc1sc(C(=O)OC2COC2)cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C9H9ClO5S2/c1-5-8(17(10,12)13)2-7(16-5)9(11)15-6-3-14-4-6/h2,6H,3-4H2,1H3 |
| InChIKey | XJZGMCGSWJBELH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |