C23H30O5 — CID 159167019
ethyl 2-hydroxy-4,6-dimethylbenzoate;ethyl 2,4,6-trimethylbenzoate (PubChem CID 159167019) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is ethyl 2-hydroxy-4,6-dimethylbenzoate;ethyl 2,4,6-trimethylbenzoate.
| Compound Name | ethyl 2-hydroxy-4,6-dimethylbenzoate;ethyl 2,4,6-trimethylbenzoate |
|---|---|
| PubChem CID | 159167019 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | ethyl 2-hydroxy-4,6-dimethylbenzoate;ethyl 2,4,6-trimethylbenzoate |
| SMILES | CCOC(=O)c1c(C)cc(C)cc1C.CCOC(=O)c1c(C)cc(C)cc1O |
| InChI | InChI=1S/C12H16O2.C11H14O3/c1-5-14-12(13)11-9(3)6-8(2)7-10(11)4;1-4-14-11(13)10-8(3)5-7(2)6-9(10)12/h6-7H,5H2,1-4H3;5-6,12H,4H2,1-3H3 |
| InChIKey | KLEUWGGILAYANL-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |