C30H32O8S — CID 4915846
diethyl 3,4-bis[(2,4,6-trimethylbenzoyl)oxy]thiophene-2,5-dicarboxylate (PubChem CID 4915846) has the molecular formula C30H32O8S and a molecular weight of 552.65 g/mol. Its IUPAC name is diethyl 3,4-bis[(2,4,6-trimethylbenzoyl)oxy]thiophene-2,5-dicarboxylate.
| Compound Name | diethyl 3,4-bis[(2,4,6-trimethylbenzoyl)oxy]thiophene-2,5-dicarboxylate |
|---|---|
| PubChem CID | 4915846 |
| Molecular Formula | C30H32O8S |
| Molecular Weight | 552.65 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | diethyl 3,4-bis[(2,4,6-trimethylbenzoyl)oxy]thiophene-2,5-dicarboxylate |
| SMILES | CCOC(=O)c1sc(C(=O)OCC)c(OC(=O)c2c(C)cc(C)cc2C)c1OC(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C30H32O8S/c1-9-35-29(33)25-23(37-27(31)21-17(5)11-15(3)12-18(21)6)24(26(39-25)30(34)36-10-2)38-28(32)22-19(7)13-16(4)14-20(22)8/h11-14H,9-10H2,1-8H3 |
| InChIKey | JPJBEEFEWYKJIV-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.65 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |