C18H19ClO2 — CID 19166017
(4-chloro-3,5-dimethylphenyl) 2,4,6-trimethylbenzoate (PubChem CID 19166017) has the molecular formula C18H19ClO2 and a molecular weight of 302.80 g/mol. Its IUPAC name is (4-chloro-3,5-dimethylphenyl) 2,4,6-trimethylbenzoate.
| Compound Name | (4-chloro-3,5-dimethylphenyl) 2,4,6-trimethylbenzoate |
|---|---|
| PubChem CID | 19166017 |
| Molecular Formula | C18H19ClO2 |
| Molecular Weight | 302.80 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | (4-chloro-3,5-dimethylphenyl) 2,4,6-trimethylbenzoate |
| SMILES | Cc1cc(C)c(C(=O)Oc2cc(C)c(Cl)c(C)c2)c(C)c1 |
| InChI | InChI=1S/C18H19ClO2/c1-10-6-11(2)16(12(3)7-10)18(20)21-15-8-13(4)17(19)14(5)9-15/h6-9H,1-5H3 |
| InChIKey | MPBXWSPRJMQJDF-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.80 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|