C18H18Cl2O3 — CID 19170867
(4-chloro-3,5-dimethylphenyl) 2-(4-chloro-3,5-dimethylphenoxy)acetate (PubChem CID 19170867) has the molecular formula C18H18Cl2O3 and a molecular weight of 353.25 g/mol. Its IUPAC name is (4-chloro-3,5-dimethylphenyl) 2-(4-chloro-3,5-dimethylphenoxy)acetate.
| Compound Name | (4-chloro-3,5-dimethylphenyl) 2-(4-chloro-3,5-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 19170867 |
| Molecular Formula | C18H18Cl2O3 |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | (4-chloro-3,5-dimethylphenyl) 2-(4-chloro-3,5-dimethylphenoxy)acetate |
| SMILES | Cc1cc(OCC(=O)Oc2cc(C)c(Cl)c(C)c2)cc(C)c1Cl |
| InChI | InChI=1S/C18H18Cl2O3/c1-10-5-14(6-11(2)17(10)19)22-9-16(21)23-15-7-12(3)18(20)13(4)8-15/h5-8H,9H2,1-4H3 |
| InChIKey | OOHPJPCJXSQKPS-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|