C13H17ClO2 — CID 78949200
1-(4-chloro-3,5-dimethylphenoxy)-3-methylbutan-2-one (PubChem CID 78949200) has the molecular formula C13H17ClO2 and a molecular weight of 240.73 g/mol. Its IUPAC name is 1-(4-chloro-3,5-dimethylphenoxy)-3-methylbutan-2-one.
| Compound Name | 1-(4-chloro-3,5-dimethylphenoxy)-3-methylbutan-2-one |
|---|---|
| PubChem CID | 78949200 |
| Molecular Formula | C13H17ClO2 |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 1-(4-chloro-3,5-dimethylphenoxy)-3-methylbutan-2-one |
| SMILES | Cc1cc(OCC(=O)C(C)C)cc(C)c1Cl |
| InChI | InChI=1S/C13H17ClO2/c1-8(2)12(15)7-16-11-5-9(3)13(14)10(4)6-11/h5-6,8H,7H2,1-4H3 |
| InChIKey | FZZCBPKSBNIURP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |