C12H15ClO2 — CID 39246924
4-(4-chloro-3,5-dimethylphenoxy)butan-2-one (PubChem CID 39246924) has the molecular formula C12H15ClO2 and a molecular weight of 226.70 g/mol. Its IUPAC name is 4-(4-chloro-3,5-dimethylphenoxy)butan-2-one.
| Compound Name | 4-(4-chloro-3,5-dimethylphenoxy)butan-2-one |
|---|---|
| PubChem CID | 39246924 |
| Molecular Formula | C12H15ClO2 |
| Molecular Weight | 226.70 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 4-(4-chloro-3,5-dimethylphenoxy)butan-2-one |
| SMILES | CC(=O)CCOc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C12H15ClO2/c1-8-6-11(7-9(2)12(8)13)15-5-4-10(3)14/h6-7H,4-5H2,1-3H3 |
| InChIKey | TWWXDIWQOLOVLC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.70 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |