C9H9Cl2NO4S — CID 116799118
(4-chloro-3,5-dimethylphenyl) N-chlorosulfonylcarbamate (PubChem CID 116799118) has the molecular formula C9H9Cl2NO4S and a molecular weight of 298.15 g/mol. Its IUPAC name is (4-chloro-3,5-dimethylphenyl) N-chlorosulfonylcarbamate.
| Compound Name | (4-chloro-3,5-dimethylphenyl) N-chlorosulfonylcarbamate |
|---|---|
| PubChem CID | 116799118 |
| Molecular Formula | C9H9Cl2NO4S |
| Molecular Weight | 298.15 g/mol |
| Exact Mass | 296.96 |
| IUPAC Name | (4-chloro-3,5-dimethylphenyl) N-chlorosulfonylcarbamate |
| SMILES | Cc1cc(OC(=O)NS(=O)(=O)Cl)cc(C)c1Cl |
| InChI | InChI=1S/C9H9Cl2NO4S/c1-5-3-7(4-6(2)8(5)10)16-9(13)12-17(11,14)15/h3-4H,1-2H3,(H,12,13) |
| InChIKey | PNKFHNBQJYPILM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.15 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |