C12H14ClNO4 — CID 82306170
3-[(4-chloro-3,5-dimethylphenoxy)carbonylamino]propanoic acid (PubChem CID 82306170) has the molecular formula C12H14ClNO4 and a molecular weight of 271.70 g/mol. Its IUPAC name is 3-[(4-chloro-3,5-dimethylphenoxy)carbonylamino]propanoic acid.
| Compound Name | 3-[(4-chloro-3,5-dimethylphenoxy)carbonylamino]propanoic acid |
|---|---|
| PubChem CID | 82306170 |
| Molecular Formula | C12H14ClNO4 |
| Molecular Weight | 271.70 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 3-[(4-chloro-3,5-dimethylphenoxy)carbonylamino]propanoic acid |
| SMILES | Cc1cc(OC(=O)NCCC(=O)O)cc(C)c1Cl |
| InChI | InChI=1S/C12H14ClNO4/c1-7-5-9(6-8(2)11(7)13)18-12(17)14-4-3-10(15)16/h5-6H,3-4H2,1-2H3,(H,14,17)(H,15,16) |
| InChIKey | PFUCVMDUNLJYBH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.70 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |