C21H33N3O6 — CID 139198999
[3,5-bis(butylcarbamoyloxy)phenyl] N-butylcarbamate (PubChem CID 139198999) has the molecular formula C21H33N3O6 and a molecular weight of 423.51 g/mol. Its IUPAC name is [3,5-bis(butylcarbamoyloxy)phenyl] N-butylcarbamate.
| Compound Name | [3,5-bis(butylcarbamoyloxy)phenyl] N-butylcarbamate |
|---|---|
| PubChem CID | 139198999 |
| Molecular Formula | C21H33N3O6 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | [3,5-bis(butylcarbamoyloxy)phenyl] N-butylcarbamate |
| SMILES | CCCCNC(=O)Oc1cc(OC(=O)NCCCC)cc(OC(=O)NCCCC)c1 |
| InChI | InChI=1S/C21H33N3O6/c1-4-7-10-22-19(25)28-16-13-17(29-20(26)23-11-8-5-2)15-18(14-16)30-21(27)24-12-9-6-3/h13-15H,4-12H2,1-3H3,(H,22,25)(H,23,26)(H,24,27) |
| InChIKey | SBXJVCQOOOALFM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|