C42H51N3O6 — CID 101189990
[4-[[3,5-bis[[4-(butylcarbamoyloxy)phenyl]methyl]phenyl]methyl]phenyl] N-butylcarbamate (PubChem CID 101189990) has the molecular formula C42H51N3O6 and a molecular weight of 693.88 g/mol. Its IUPAC name is [4-[[3,5-bis[[4-(butylcarbamoyloxy)phenyl]methyl]phenyl]methyl]phenyl] N-butylcarbamate.
| Compound Name | [4-[[3,5-bis[[4-(butylcarbamoyloxy)phenyl]methyl]phenyl]methyl]phenyl] N-butylcarbamate |
|---|---|
| PubChem CID | 101189990 |
| Molecular Formula | C42H51N3O6 |
| Molecular Weight | 693.88 g/mol |
| Exact Mass | 693.38 |
| IUPAC Name | [4-[[3,5-bis[[4-(butylcarbamoyloxy)phenyl]methyl]phenyl]methyl]phenyl] N-butylcarbamate |
| SMILES | CCCCNC(=O)Oc1ccc(Cc2cc(Cc3ccc(OC(=O)NCCCC)cc3)cc(Cc3ccc(OC(=O)NCCCC)cc3)c2)cc1 |
| InChI | InChI=1S/C42H51N3O6/c1-4-7-22-43-40(46)49-37-16-10-31(11-17-37)25-34-28-35(26-32-12-18-38(19-13-32)50-41(47)44-23-8-5-2)30-36(29-34)27-33-14-20-39(21-15-33)51-42(48)45-24-9-6-3/h10-21,28-30H,4-9,22-27H2,1-3H3,(H,43,46)(H,44,47)(H,45,48) |
| InChIKey | DEKVZYSOCZHIPD-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.88 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|