C16H16Cl2N2O3 — CID 23635766
[4-[(3,5-dichloro-2-pyridinyl)oxy]phenyl] N-butylcarbamate (PubChem CID 23635766) has the molecular formula C16H16Cl2N2O3 and a molecular weight of 355.22 g/mol. Its IUPAC name is [4-[(3,5-dichloro-2-pyridinyl)oxy]phenyl] N-butylcarbamate.
| Compound Name | [4-[(3,5-dichloro-2-pyridinyl)oxy]phenyl] N-butylcarbamate |
|---|---|
| PubChem CID | 23635766 |
| Molecular Formula | C16H16Cl2N2O3 |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | [4-[(3,5-dichloro-2-pyridinyl)oxy]phenyl] N-butylcarbamate |
| SMILES | CCCCNC(=O)Oc1ccc(Oc2ncc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C16H16Cl2N2O3/c1-2-3-8-19-16(21)23-13-6-4-12(5-7-13)22-15-14(18)9-11(17)10-20-15/h4-7,9-10H,2-3,8H2,1H3,(H,19,21) |
| InChIKey | IIEMZQTXNZURFZ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|