C34H52N2O6S — CID 102112450
[4-[4-(decylcarbamoyloxy)phenyl]sulfonylphenyl] N-decylcarbamate (PubChem CID 102112450) has the molecular formula C34H52N2O6S and a molecular weight of 616.87 g/mol. Its IUPAC name is [4-[4-(decylcarbamoyloxy)phenyl]sulfonylphenyl] N-decylcarbamate.
| Compound Name | [4-[4-(decylcarbamoyloxy)phenyl]sulfonylphenyl] N-decylcarbamate |
|---|---|
| PubChem CID | 102112450 |
| Molecular Formula | C34H52N2O6S |
| Molecular Weight | 616.87 g/mol |
| Exact Mass | 616.35 |
| IUPAC Name | [4-[4-(decylcarbamoyloxy)phenyl]sulfonylphenyl] N-decylcarbamate |
| SMILES | CCCCCCCCCCNC(=O)Oc1ccc(S(=O)(=O)c2ccc(OC(=O)NCCCCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C34H52N2O6S/c1-3-5-7-9-11-13-15-17-27-35-33(37)41-29-19-23-31(24-20-29)43(39,40)32-25-21-30(22-26-32)42-34(38)36-28-18-16-14-12-10-8-6-4-2/h19-26H,3-18,27-28H2,1-2H3,(H,35,37)(H,36,38) |
| InChIKey | ZLWPRGOMGIVLFH-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.87 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|