C24H28N2O8 — CID 2834246
methyl 4-[6-[(4-methoxycarbonylphenoxy)carbonylamino]hexylcarbamoyloxy]benzoate (PubChem CID 2834246) has the molecular formula C24H28N2O8 and a molecular weight of 472.49 g/mol. Its IUPAC name is methyl 4-[6-[(4-methoxycarbonylphenoxy)carbonylamino]hexylcarbamoyloxy]benzoate.
| Compound Name | methyl 4-[6-[(4-methoxycarbonylphenoxy)carbonylamino]hexylcarbamoyloxy]benzoate |
|---|---|
| PubChem CID | 2834246 |
| Molecular Formula | C24H28N2O8 |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | methyl 4-[6-[(4-methoxycarbonylphenoxy)carbonylamino]hexylcarbamoyloxy]benzoate |
| SMILES | COC(=O)c1ccc(OC(=O)NCCCCCCNC(=O)Oc2ccc(C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C24H28N2O8/c1-31-21(27)17-7-11-19(12-8-17)33-23(29)25-15-5-3-4-6-16-26-24(30)34-20-13-9-18(10-14-20)22(28)32-2/h7-14H,3-6,15-16H2,1-2H3,(H,25,29)(H,26,30) |
| InChIKey | DZCNXIMEDDZPLO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|