C24H32N2O6 — CID 67180754
(4-ethoxyphenyl) N-[6-[(4-ethoxyphenoxy)carbonylamino]hexyl]carbamate (PubChem CID 67180754) has the molecular formula C24H32N2O6 and a molecular weight of 444.53 g/mol. Its IUPAC name is (4-ethoxyphenyl) N-[6-[(4-ethoxyphenoxy)carbonylamino]hexyl]carbamate.
| Compound Name | (4-ethoxyphenyl) N-[6-[(4-ethoxyphenoxy)carbonylamino]hexyl]carbamate |
|---|---|
| PubChem CID | 67180754 |
| Molecular Formula | C24H32N2O6 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | (4-ethoxyphenyl) N-[6-[(4-ethoxyphenoxy)carbonylamino]hexyl]carbamate |
| SMILES | CCOc1ccc(OC(=O)NCCCCCCNC(=O)Oc2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C24H32N2O6/c1-3-29-19-9-13-21(14-10-19)31-23(27)25-17-7-5-6-8-18-26-24(28)32-22-15-11-20(12-16-22)30-4-2/h9-16H,3-8,17-18H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | PFFDEOKQQFEURD-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|