C14H19NO4S — CID 10780347
6-[(4-methylsulfanylphenoxy)carbonylamino]hexanoic acid (PubChem CID 10780347) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is 6-[(4-methylsulfanylphenoxy)carbonylamino]hexanoic acid.
| Compound Name | 6-[(4-methylsulfanylphenoxy)carbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 10780347 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 6-[(4-methylsulfanylphenoxy)carbonylamino]hexanoic acid |
| SMILES | CSc1ccc(OC(=O)NCCCCCC(=O)O)cc1 |
| InChI | InChI=1S/C14H19NO4S/c1-20-12-8-6-11(7-9-12)19-14(18)15-10-4-2-3-5-13(16)17/h6-9H,2-5,10H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | FSHBGHMYYKOUNX-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|