C18H23NO4 — CID 58895309
methyl 4-[[(2E,6Z)-nona-2,6-dienyl]carbamoyloxy]benzoate (PubChem CID 58895309) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is methyl 4-[[(2E,6Z)-nona-2,6-dienyl]carbamoyloxy]benzoate.
| Compound Name | methyl 4-[[(2E,6Z)-nona-2,6-dienyl]carbamoyloxy]benzoate |
|---|---|
| PubChem CID | 58895309 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | methyl 4-[[(2E,6Z)-nona-2,6-dienyl]carbamoyloxy]benzoate |
| SMILES | CC/C=C\CC/C=C/CNC(=O)Oc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C18H23NO4/c1-3-4-5-6-7-8-9-14-19-18(21)23-16-12-10-15(11-13-16)17(20)22-2/h4-5,8-13H,3,6-7,14H2,1-2H3,(H,19,21)/b5-4-,9-8+ |
| InChIKey | LAQIXXHXPAGMIY-FTGFODROSA-N |
| XLogP | 3.86 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|