C20H30NNaO6S — CID 23682249
sodium 4-[5-(nonanoylamino)pentanoyloxy]benzenesulfonate (PubChem CID 23682249) has the molecular formula C20H30NNaO6S and a molecular weight of 435.52 g/mol. Its IUPAC name is sodium 4-[5-(nonanoylamino)pentanoyloxy]benzenesulfonate.
| Compound Name | sodium 4-[5-(nonanoylamino)pentanoyloxy]benzenesulfonate |
|---|---|
| PubChem CID | 23682249 |
| Molecular Formula | C20H30NNaO6S |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | sodium 4-[5-(nonanoylamino)pentanoyloxy]benzenesulfonate |
| SMILES | CCCCCCCCC(=O)NCCCCC(=O)Oc1ccc(S(=O)(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C20H31NO6S.Na/c1-2-3-4-5-6-7-10-19(22)21-16-9-8-11-20(23)27-17-12-14-18(15-13-17)28(24,25)26;/h12-15H,2-11,16H2,1H3,(H,21,22)(H,24,25,26);/q;+1/p-1 |
| InChIKey | IMBUJRYAOYZMTN-UHFFFAOYSA-M |
| XLogP | 0.54 |
| TPSA | 112.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|