C28H46N2O7S — CID 57255329
3-[6-(decanoylamino)hexanoylamino]-4-hexanoyloxybenzenesulfonic acid (PubChem CID 57255329) has the molecular formula C28H46N2O7S and a molecular weight of 554.75 g/mol. Its IUPAC name is 3-[6-(decanoylamino)hexanoylamino]-4-hexanoyloxybenzenesulfonic acid.
| Compound Name | 3-[6-(decanoylamino)hexanoylamino]-4-hexanoyloxybenzenesulfonic acid |
|---|---|
| PubChem CID | 57255329 |
| Molecular Formula | C28H46N2O7S |
| Molecular Weight | 554.75 g/mol |
| Exact Mass | 554.30 |
| IUPAC Name | 3-[6-(decanoylamino)hexanoylamino]-4-hexanoyloxybenzenesulfonic acid |
| SMILES | CCCCCCCCCC(=O)NCCCCCC(=O)Nc1cc(S(=O)(=O)O)ccc1OC(=O)CCCCC |
| InChI | InChI=1S/C28H46N2O7S/c1-3-5-7-8-9-10-13-16-26(31)29-21-15-11-14-17-27(32)30-24-22-23(38(34,35)36)19-20-25(24)37-28(33)18-12-6-4-2/h19-20,22H,3-18,21H2,1-2H3,(H,29,31)(H,30,32)(H,34,35,36) |
| InChIKey | IDGWXQXJYOBTEA-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 138.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.75 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|