C22H35NO6S — CID 21226520
2-[6-(decanoylamino)hexanoyloxy]benzenesulfonic acid (PubChem CID 21226520) has the molecular formula C22H35NO6S and a molecular weight of 441.59 g/mol. Its IUPAC name is 2-[6-(decanoylamino)hexanoyloxy]benzenesulfonic acid.
| Compound Name | 2-[6-(decanoylamino)hexanoyloxy]benzenesulfonic acid |
|---|---|
| PubChem CID | 21226520 |
| Molecular Formula | C22H35NO6S |
| Molecular Weight | 441.59 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 2-[6-(decanoylamino)hexanoyloxy]benzenesulfonic acid |
| SMILES | CCCCCCCCCC(=O)NCCCCCC(=O)Oc1ccccc1S(=O)(=O)O |
| InChI | InChI=1S/C22H35NO6S/c1-2-3-4-5-6-7-9-16-21(24)23-18-13-8-10-17-22(25)29-19-14-11-12-15-20(19)30(26,27)28/h11-12,14-15H,2-10,13,16-18H2,1H3,(H,23,24)(H,26,27,28) |
| InChIKey | GOKVKLCCWGRQJV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.59 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|