C22H33NO7S — CID 141057477
(2,2-dioxo-1,3,2λ6-benzodioxathiol-4-yl) 6-(decanoylamino)hexanoate (PubChem CID 141057477) has the molecular formula C22H33NO7S and a molecular weight of 455.57 g/mol. Its IUPAC name is (2,2-dioxo-1,3,2λ6-benzodioxathiol-4-yl) 6-(decanoylamino)hexanoate.
| Compound Name | (2,2-dioxo-1,3,2λ6-benzodioxathiol-4-yl) 6-(decanoylamino)hexanoate |
|---|---|
| PubChem CID | 141057477 |
| Molecular Formula | C22H33NO7S |
| Molecular Weight | 455.57 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | (2,2-dioxo-1,3,2λ6-benzodioxathiol-4-yl) 6-(decanoylamino)hexanoate |
| SMILES | CCCCCCCCCC(=O)NCCCCCC(=O)Oc1cccc2c1OS(=O)(=O)O2 |
| InChI | InChI=1S/C22H33NO7S/c1-2-3-4-5-6-7-9-15-20(24)23-17-11-8-10-16-21(25)28-18-13-12-14-19-22(18)30-31(26,27)29-19/h12-14H,2-11,15-17H2,1H3,(H,23,24) |
| InChIKey | QVCZJUWLIZCVRB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.57 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|