About (3,4-dichlorophenyl) N-(3-hydroxypropyl)carbamate
(3,4-dichlorophenyl) N-(3-hydroxypropyl)carbamate (PubChem CID 116819713) has the molecular formula C10H11Cl2NO3
and a molecular weight of 264.11 g/mol. Its IUPAC name is (3,4-dichlorophenyl) N-(3-hydroxypropyl)carbamate.
Molecular Properties
| Compound Name | (3,4-dichlorophenyl) N-(3-hydroxypropyl)carbamate |
| PubChem CID | 116819713 |
| Molecular Formula | C10H11Cl2NO3 |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | (3,4-dichlorophenyl) N-(3-hydroxypropyl)carbamate |
| SMILES | O=C(NCCCO)Oc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H11Cl2NO3/c11-8-3-2-7(6-9(8)12)16-10(15)13-4-1-5-14/h2-3,6,14H,1,4-5H2,(H,13,15) |
| InChIKey | GNKIOSGVRWMNAV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3,4-dichlorophenyl) N-(3-hydroxypropyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dichlorophenyl) N-(3-hydroxypropyl)carbamate?
The IUPAC name of (3,4-dichlorophenyl) N-(3-hydroxypropyl)carbamate (CID 116819713) is (3,4-dichlorophenyl) N-(3-hydroxypropyl)carbamate.
What is the SMILES notation for (3,4-dichlorophenyl) N-(3-hydroxypropyl)carbamate?
The canonical SMILES for (3,4-dichlorophenyl) N-(3-hydroxypropyl)carbamate is O=C(NCCCO)Oc1ccc(Cl)c(Cl)c1.
What is the InChIKey of (3,4-dichlorophenyl) N-(3-hydroxypropyl)carbamate?
The InChIKey is GNKIOSGVRWMNAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11Cl2NO3/c11-8-3-2-7(6-9(8)12)16-10(15)13-4-1-5-14/h2-3,6,14H,1,4-5H2,(H,13,15).
What are the key properties of (3,4-dichlorophenyl) N-(3-hydroxypropyl)carbamate?
(3,4-dichlorophenyl) N-(3-hydroxypropyl)carbamate has a molecular weight of 264.11 g/mol, XLogP of 2.46, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dichlorophenyl) N-(3-hydroxypropyl)carbamate is sourced from PubChem (CID 116819713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).