C12H13Cl2NO2 — CID 43417822
(E)-3-(3,4-dichlorophenyl)-N-(3-hydroxypropyl)prop-2-enamide (PubChem CID 43417822) has the molecular formula C12H13Cl2NO2 and a molecular weight of 274.15 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-(3-hydroxypropyl)prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-(3-hydroxypropyl)prop-2-enamide |
|---|---|
| PubChem CID | 43417822 |
| Molecular Formula | C12H13Cl2NO2 |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-(3-hydroxypropyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)NCCCO |
| InChI | InChI=1S/C12H13Cl2NO2/c13-10-4-2-9(8-11(10)14)3-5-12(17)15-6-1-7-16/h2-5,8,16H,1,6-7H2,(H,15,17)/b5-3+ |
| InChIKey | PJAUJSVAEHUXHH-HWKANZROSA-N |
| XLogP | 2.51 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|