C26H20Cl4N2O2 — CID 3261410
3-(3,4-dichlorophenyl)-N-[[3-[[3-(3,4-dichlorophenyl)prop-2-enoylamino]methyl]phenyl]methyl]prop-2-enamide (PubChem CID 3261410) has the molecular formula C26H20Cl4N2O2 and a molecular weight of 534.27 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N-[[3-[[3-(3,4-dichlorophenyl)prop-2-enoylamino]methyl]phenyl]methyl]prop-2-enamide.
| Compound Name | 3-(3,4-dichlorophenyl)-N-[[3-[[3-(3,4-dichlorophenyl)prop-2-enoylamino]methyl]phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 3261410 |
| Molecular Formula | C26H20Cl4N2O2 |
| Molecular Weight | 534.27 g/mol |
| Exact Mass | 532.03 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N-[[3-[[3-(3,4-dichlorophenyl)prop-2-enoylamino]methyl]phenyl]methyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)c(Cl)c1)NCc1cccc(CNC(=O)C=Cc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C26H20Cl4N2O2/c27-21-8-4-17(13-23(21)29)6-10-25(33)31-15-19-2-1-3-20(12-19)16-32-26(34)11-7-18-5-9-22(28)24(30)14-18/h1-14H,15-16H2,(H,31,33)(H,32,34) |
| InChIKey | GGLCMOBMEPEQTE-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.27 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|