C15H19Cl2NO2 — CID 103861421
(E)-3-(3,4-dichlorophenyl)-N-(5-hydroxy-4-methylpentyl)prop-2-enamide (PubChem CID 103861421) has the molecular formula C15H19Cl2NO2 and a molecular weight of 316.23 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-(5-hydroxy-4-methylpentyl)prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-(5-hydroxy-4-methylpentyl)prop-2-enamide |
|---|---|
| PubChem CID | 103861421 |
| Molecular Formula | C15H19Cl2NO2 |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-(5-hydroxy-4-methylpentyl)prop-2-enamide |
| SMILES | CC(CO)CCCNC(=O)/C=C/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H19Cl2NO2/c1-11(10-19)3-2-8-18-15(20)7-5-12-4-6-13(16)14(17)9-12/h4-7,9,11,19H,2-3,8,10H2,1H3,(H,18,20)/b7-5+ |
| InChIKey | PCDKYSMYOZUXFD-FNORWQNLSA-N |
| XLogP | 3.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|