About 3-(3,4-dichlorophenyl)-N-(3-methoxypropyl)prop-2-enamide
3-(3,4-dichlorophenyl)-N-(3-methoxypropyl)prop-2-enamide (PubChem CID 4676391) has the molecular formula C13H15Cl2NO2
and a molecular weight of 288.17 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N-(3-methoxypropyl)prop-2-enamide.
Molecular Properties
| Compound Name | 3-(3,4-dichlorophenyl)-N-(3-methoxypropyl)prop-2-enamide |
| PubChem CID | 4676391 |
| Molecular Formula | C13H15Cl2NO2 |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N-(3-methoxypropyl)prop-2-enamide |
| SMILES | COCCCNC(=O)C=Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H15Cl2NO2/c1-18-8-2-7-16-13(17)6-4-10-3-5-11(14)12(15)9-10/h3-6,9H,2,7-8H2,1H3,(H,16,17) |
| InChIKey | WOCCGNKQWKNOBK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,4-dichlorophenyl)-N-(3-methoxypropyl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dichlorophenyl)-N-(3-methoxypropyl)prop-2-enamide?
The IUPAC name of 3-(3,4-dichlorophenyl)-N-(3-methoxypropyl)prop-2-enamide (CID 4676391) is 3-(3,4-dichlorophenyl)-N-(3-methoxypropyl)prop-2-enamide.
What is the SMILES notation for 3-(3,4-dichlorophenyl)-N-(3-methoxypropyl)prop-2-enamide?
The canonical SMILES for 3-(3,4-dichlorophenyl)-N-(3-methoxypropyl)prop-2-enamide is COCCCNC(=O)C=Cc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 3-(3,4-dichlorophenyl)-N-(3-methoxypropyl)prop-2-enamide?
The InChIKey is WOCCGNKQWKNOBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15Cl2NO2/c1-18-8-2-7-16-13(17)6-4-10-3-5-11(14)12(15)9-10/h3-6,9H,2,7-8H2,1H3,(H,16,17).
What are the key properties of 3-(3,4-dichlorophenyl)-N-(3-methoxypropyl)prop-2-enamide?
3-(3,4-dichlorophenyl)-N-(3-methoxypropyl)prop-2-enamide has a molecular weight of 288.17 g/mol, XLogP of 3.16, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dichlorophenyl)-N-(3-methoxypropyl)prop-2-enamide is sourced from PubChem (CID 4676391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).