C14H14Cl2N4O — CID 77044382
3-(3,4-dichlorophenyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]prop-2-enamide (PubChem CID 77044382) has the molecular formula C14H14Cl2N4O and a molecular weight of 325.20 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]prop-2-enamide.
| Compound Name | 3-(3,4-dichlorophenyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 77044382 |
| Molecular Formula | C14H14Cl2N4O |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N-[3-(1H-1,2,4-triazol-5-yl)propyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)c(Cl)c1)NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C14H14Cl2N4O/c15-11-5-3-10(8-12(11)16)4-6-14(21)17-7-1-2-13-18-9-19-20-13/h3-6,8-9H,1-2,7H2,(H,17,21)(H,18,19,20) |
| InChIKey | WRLYUCKPENAQON-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|