C13H12ClFN4O — CID 77044373
3-(2-chloro-6-fluorophenyl)-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]prop-2-enamide (PubChem CID 77044373) has the molecular formula C13H12ClFN4O and a molecular weight of 294.72 g/mol. Its IUPAC name is 3-(2-chloro-6-fluorophenyl)-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]prop-2-enamide.
| Compound Name | 3-(2-chloro-6-fluorophenyl)-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 77044373 |
| Molecular Formula | C13H12ClFN4O |
| Molecular Weight | 294.72 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 3-(2-chloro-6-fluorophenyl)-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]prop-2-enamide |
| SMILES | O=C(C=Cc1c(F)cccc1Cl)NCCc1ncn[nH]1 |
| InChI | InChI=1S/C13H12ClFN4O/c14-10-2-1-3-11(15)9(10)4-5-13(20)16-7-6-12-17-8-18-19-12/h1-5,8H,6-7H2,(H,16,20)(H,17,18,19) |
| InChIKey | ZNLLBXFHIGIUKO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.72 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|