C13H13FN4O — CID 77044250
3-(4-fluorophenyl)-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]prop-2-enamide (PubChem CID 77044250) has the molecular formula C13H13FN4O and a molecular weight of 260.27 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]prop-2-enamide.
| Compound Name | 3-(4-fluorophenyl)-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 77044250 |
| Molecular Formula | C13H13FN4O |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 3-(4-fluorophenyl)-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(F)cc1)NCCc1ncn[nH]1 |
| InChI | InChI=1S/C13H13FN4O/c14-11-4-1-10(2-5-11)3-6-13(19)15-8-7-12-16-9-17-18-12/h1-6,9H,7-8H2,(H,15,19)(H,16,17,18) |
| InChIKey | YJHNCOPXHLXFHV-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|