C9H12N4O3 — CID 77044355
4-oxo-4-[3-(1H-1,2,4-triazol-5-yl)propylamino]but-2-enoic acid (PubChem CID 77044355) has the molecular formula C9H12N4O3 and a molecular weight of 224.22 g/mol. Its IUPAC name is 4-oxo-4-[3-(1H-1,2,4-triazol-5-yl)propylamino]but-2-enoic acid.
| Compound Name | 4-oxo-4-[3-(1H-1,2,4-triazol-5-yl)propylamino]but-2-enoic acid |
|---|---|
| PubChem CID | 77044355 |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 4-oxo-4-[3-(1H-1,2,4-triazol-5-yl)propylamino]but-2-enoic acid |
| SMILES | O=C(O)C=CC(=O)NCCCc1ncn[nH]1 |
| InChI | InChI=1S/C9H12N4O3/c14-8(3-4-9(15)16)10-5-1-2-7-11-6-12-13-7/h3-4,6H,1-2,5H2,(H,10,14)(H,15,16)(H,11,12,13) |
| InChIKey | VVBKNUHHCYANRH-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|