C7H10N4O — CID 64547195
N-[2-(1H-1,2,4-triazol-5-yl)ethyl]prop-2-enamide (PubChem CID 64547195) has the molecular formula C7H10N4O and a molecular weight of 166.18 g/mol. Its IUPAC name is N-[2-(1H-1,2,4-triazol-5-yl)ethyl]prop-2-enamide.
| Compound Name | N-[2-(1H-1,2,4-triazol-5-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 64547195 |
| Molecular Formula | C7H10N4O |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | N-[2-(1H-1,2,4-triazol-5-yl)ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCCc1ncn[nH]1 |
| InChI | InChI=1S/C7H10N4O/c1-2-7(12)8-4-3-6-9-5-10-11-6/h2,5H,1,3-4H2,(H,8,12)(H,9,10,11) |
| InChIKey | VLDQSMPHGKBEMZ-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|