C6H8N4O — CID 60977964
N-(1H-1,2,4-triazol-5-ylmethyl)prop-2-enamide (PubChem CID 60977964) has the molecular formula C6H8N4O and a molecular weight of 152.16 g/mol. Its IUPAC name is N-(1H-1,2,4-triazol-5-ylmethyl)prop-2-enamide.
| Compound Name | N-(1H-1,2,4-triazol-5-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 60977964 |
| Molecular Formula | C6H8N4O |
| Molecular Weight | 152.16 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | N-(1H-1,2,4-triazol-5-ylmethyl)prop-2-enamide |
| SMILES | C=CC(=O)NCc1ncn[nH]1 |
| InChI | InChI=1S/C6H8N4O/c1-2-6(11)7-3-5-8-4-9-10-5/h2,4H,1,3H2,(H,7,11)(H,8,9,10) |
| InChIKey | IVFZWFVYWJVYOT-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.16 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|