C5H7BrN4O — CID 63678962
2-bromo-N-(1H-1,2,4-triazol-5-ylmethyl)acetamide (PubChem CID 63678962) has the molecular formula C5H7BrN4O and a molecular weight of 219.04 g/mol. Its IUPAC name is 2-bromo-N-(1H-1,2,4-triazol-5-ylmethyl)acetamide.
| Compound Name | 2-bromo-N-(1H-1,2,4-triazol-5-ylmethyl)acetamide |
|---|---|
| PubChem CID | 63678962 |
| Molecular Formula | C5H7BrN4O |
| Molecular Weight | 219.04 g/mol |
| Exact Mass | 217.98 |
| IUPAC Name | 2-bromo-N-(1H-1,2,4-triazol-5-ylmethyl)acetamide |
| SMILES | O=C(CBr)NCc1ncn[nH]1 |
| InChI | InChI=1S/C5H7BrN4O/c6-1-5(11)7-2-4-8-3-9-10-4/h3H,1-2H2,(H,7,11)(H,8,9,10) |
| InChIKey | KYVSEXOQWXOVLB-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.04 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|