C8H15N5O2 — CID 103155320
4-amino-3-methoxy-N-(1H-1,2,4-triazol-5-ylmethyl)butanamide (PubChem CID 103155320) has the molecular formula C8H15N5O2 and a molecular weight of 213.24 g/mol. Its IUPAC name is 4-amino-3-methoxy-N-(1H-1,2,4-triazol-5-ylmethyl)butanamide.
| Compound Name | 4-amino-3-methoxy-N-(1H-1,2,4-triazol-5-ylmethyl)butanamide |
|---|---|
| PubChem CID | 103155320 |
| Molecular Formula | C8H15N5O2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 4-amino-3-methoxy-N-(1H-1,2,4-triazol-5-ylmethyl)butanamide |
| SMILES | COC(CN)CC(=O)NCc1ncn[nH]1 |
| InChI | InChI=1S/C8H15N5O2/c1-15-6(3-9)2-8(14)10-4-7-11-5-12-13-7/h5-6H,2-4,9H2,1H3,(H,10,14)(H,11,12,13) |
| InChIKey | XLWQBACZLBJTHJ-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |