C9H14N4O3 — CID 60978215
6-oxo-6-(1H-1,2,4-triazol-5-ylmethylamino)hexanoic acid (PubChem CID 60978215) has the molecular formula C9H14N4O3 and a molecular weight of 226.24 g/mol. Its IUPAC name is 6-oxo-6-(1H-1,2,4-triazol-5-ylmethylamino)hexanoic acid.
| Compound Name | 6-oxo-6-(1H-1,2,4-triazol-5-ylmethylamino)hexanoic acid |
|---|---|
| PubChem CID | 60978215 |
| Molecular Formula | C9H14N4O3 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 6-oxo-6-(1H-1,2,4-triazol-5-ylmethylamino)hexanoic acid |
| SMILES | O=C(O)CCCCC(=O)NCc1ncn[nH]1 |
| InChI | InChI=1S/C9H14N4O3/c14-8(3-1-2-4-9(15)16)10-5-7-11-6-12-13-7/h6H,1-5H2,(H,10,14)(H,15,16)(H,11,12,13) |
| InChIKey | ATSXHUZEZXNKDR-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|