C9H15N5O3 — CID 64525497
4-(1H-1,2,4-triazol-5-ylmethylcarbamoylamino)pentanoic acid (PubChem CID 64525497) has the molecular formula C9H15N5O3 and a molecular weight of 241.25 g/mol. Its IUPAC name is 4-(1H-1,2,4-triazol-5-ylmethylcarbamoylamino)pentanoic acid.
| Compound Name | 4-(1H-1,2,4-triazol-5-ylmethylcarbamoylamino)pentanoic acid |
|---|---|
| PubChem CID | 64525497 |
| Molecular Formula | C9H15N5O3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 4-(1H-1,2,4-triazol-5-ylmethylcarbamoylamino)pentanoic acid |
| SMILES | CC(CCC(=O)O)NC(=O)NCc1ncn[nH]1 |
| InChI | InChI=1S/C9H15N5O3/c1-6(2-3-8(15)16)13-9(17)10-4-7-11-5-12-14-7/h5-6H,2-4H2,1H3,(H,15,16)(H2,10,13,17)(H,11,12,14) |
| InChIKey | OJOVMUGZYYWEJE-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |