C9H15N5O4 — CID 112739316
3-[2-(1H-1,2,4-triazol-5-ylmethylcarbamoylamino)ethoxy]propanoic acid (PubChem CID 112739316) has the molecular formula C9H15N5O4 and a molecular weight of 257.25 g/mol. Its IUPAC name is 3-[2-(1H-1,2,4-triazol-5-ylmethylcarbamoylamino)ethoxy]propanoic acid.
| Compound Name | 3-[2-(1H-1,2,4-triazol-5-ylmethylcarbamoylamino)ethoxy]propanoic acid |
|---|---|
| PubChem CID | 112739316 |
| Molecular Formula | C9H15N5O4 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 3-[2-(1H-1,2,4-triazol-5-ylmethylcarbamoylamino)ethoxy]propanoic acid |
| SMILES | O=C(O)CCOCCNC(=O)NCc1ncn[nH]1 |
| InChI | InChI=1S/C9H15N5O4/c15-8(16)1-3-18-4-2-10-9(17)11-5-7-12-6-13-14-7/h6H,1-5H2,(H,15,16)(H2,10,11,17)(H,12,13,14) |
| InChIKey | KUOUPZIVBZOZDM-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 129.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|