C7H12N6O2 — CID 64517400
N-(2-aminoethyl)-N'-(1H-1,2,4-triazol-5-ylmethyl)oxamide (PubChem CID 64517400) has the molecular formula C7H12N6O2 and a molecular weight of 212.21 g/mol. Its IUPAC name is N-(2-aminoethyl)-N'-(1H-1,2,4-triazol-5-ylmethyl)oxamide.
| Compound Name | N-(2-aminoethyl)-N'-(1H-1,2,4-triazol-5-ylmethyl)oxamide |
|---|---|
| PubChem CID | 64517400 |
| Molecular Formula | C7H12N6O2 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | N-(2-aminoethyl)-N'-(1H-1,2,4-triazol-5-ylmethyl)oxamide |
| SMILES | NCCNC(=O)C(=O)NCc1ncn[nH]1 |
| InChI | InChI=1S/C7H12N6O2/c8-1-2-9-6(14)7(15)10-3-5-11-4-12-13-5/h4H,1-3,8H2,(H,9,14)(H,10,15)(H,11,12,13) |
| InChIKey | YIDSJWUCROBOOF-UHFFFAOYSA-N |
| XLogP | -2.50 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|