C11H11N5OS — CID 64530382
4-carbamothioyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide (PubChem CID 64530382) has the molecular formula C11H11N5OS and a molecular weight of 261.31 g/mol. Its IUPAC name is 4-carbamothioyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide.
| Compound Name | 4-carbamothioyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 64530382 |
| Molecular Formula | C11H11N5OS |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 4-carbamothioyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide |
| SMILES | NC(=S)c1ccc(C(=O)NCc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C11H11N5OS/c12-10(18)7-1-3-8(4-2-7)11(17)13-5-9-14-6-15-16-9/h1-4,6H,5H2,(H2,12,18)(H,13,17)(H,14,15,16) |
| InChIKey | IEEQZVKDUPVMDO-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|