C10H8BrFN4O — CID 113244827
3-bromo-4-fluoro-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide (PubChem CID 113244827) has the molecular formula C10H8BrFN4O and a molecular weight of 299.10 g/mol. Its IUPAC name is 3-bromo-4-fluoro-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide.
| Compound Name | 3-bromo-4-fluoro-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 113244827 |
| Molecular Formula | C10H8BrFN4O |
| Molecular Weight | 299.10 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | 3-bromo-4-fluoro-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide |
| SMILES | O=C(NCc1ncn[nH]1)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C10H8BrFN4O/c11-7-3-6(1-2-8(7)12)10(17)13-4-9-14-5-15-16-9/h1-3,5H,4H2,(H,13,17)(H,14,15,16) |
| InChIKey | NUSBBTRWRZTGAF-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.10 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |