C9H8ClN5O — CID 60983185
6-chloro-N-(1H-1,2,4-triazol-5-ylmethyl)pyridine-3-carboxamide (PubChem CID 60983185) has the molecular formula C9H8ClN5O and a molecular weight of 237.65 g/mol. Its IUPAC name is 6-chloro-N-(1H-1,2,4-triazol-5-ylmethyl)pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-(1H-1,2,4-triazol-5-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 60983185 |
| Molecular Formula | C9H8ClN5O |
| Molecular Weight | 237.65 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 6-chloro-N-(1H-1,2,4-triazol-5-ylmethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCc1ncn[nH]1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C9H8ClN5O/c10-7-2-1-6(3-11-7)9(16)12-4-8-13-5-14-15-8/h1-3,5H,4H2,(H,12,16)(H,13,14,15) |
| InChIKey | OTTBWUHFRCEHDC-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.65 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|