C11H11ClN4O3S — CID 60982539
4-chloro-3-methylsulfonyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide (PubChem CID 60982539) has the molecular formula C11H11ClN4O3S and a molecular weight of 314.75 g/mol. Its IUPAC name is 4-chloro-3-methylsulfonyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide.
| Compound Name | 4-chloro-3-methylsulfonyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 60982539 |
| Molecular Formula | C11H11ClN4O3S |
| Molecular Weight | 314.75 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 4-chloro-3-methylsulfonyl-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide |
| SMILES | CS(=O)(=O)c1cc(C(=O)NCc2ncn[nH]2)ccc1Cl |
| InChI | InChI=1S/C11H11ClN4O3S/c1-20(18,19)9-4-7(2-3-8(9)12)11(17)13-5-10-14-6-15-16-10/h2-4,6H,5H2,1H3,(H,13,17)(H,14,15,16) |
| InChIKey | BRHRYESDINBHSW-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.75 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |