C13H16N4O3 — CID 60982282
4-ethoxy-3-methoxy-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide (PubChem CID 60982282) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is 4-ethoxy-3-methoxy-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide.
| Compound Name | 4-ethoxy-3-methoxy-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 60982282 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 4-ethoxy-3-methoxy-N-(1H-1,2,4-triazol-5-ylmethyl)benzamide |
| SMILES | CCOc1ccc(C(=O)NCc2ncn[nH]2)cc1OC |
| InChI | InChI=1S/C13H16N4O3/c1-3-20-10-5-4-9(6-11(10)19-2)13(18)14-7-12-15-8-16-17-12/h4-6,8H,3,7H2,1-2H3,(H,14,18)(H,15,16,17) |
| InChIKey | WCZIQGYGWFEFIM-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |