C9H11N7O — CID 64525579
6-hydrazinyl-N-(1H-1,2,4-triazol-5-ylmethyl)pyridine-3-carboxamide (PubChem CID 64525579) has the molecular formula C9H11N7O and a molecular weight of 233.24 g/mol. Its IUPAC name is 6-hydrazinyl-N-(1H-1,2,4-triazol-5-ylmethyl)pyridine-3-carboxamide.
| Compound Name | 6-hydrazinyl-N-(1H-1,2,4-triazol-5-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 64525579 |
| Molecular Formula | C9H11N7O |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 6-hydrazinyl-N-(1H-1,2,4-triazol-5-ylmethyl)pyridine-3-carboxamide |
| SMILES | NNc1ccc(C(=O)NCc2ncn[nH]2)cn1 |
| InChI | InChI=1S/C9H11N7O/c10-15-7-2-1-6(3-11-7)9(17)12-4-8-13-5-14-16-8/h1-3,5H,4,10H2,(H,11,15)(H,12,17)(H,13,14,16) |
| InChIKey | CTDPIEKCDWSRKX-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|