C9H10ClN7O — CID 64524391
3-chloro-6-hydrazinyl-N-(1H-1,2,4-triazol-5-ylmethyl)pyridine-2-carboxamide (PubChem CID 64524391) has the molecular formula C9H10ClN7O and a molecular weight of 267.68 g/mol. Its IUPAC name is 3-chloro-6-hydrazinyl-N-(1H-1,2,4-triazol-5-ylmethyl)pyridine-2-carboxamide.
| Compound Name | 3-chloro-6-hydrazinyl-N-(1H-1,2,4-triazol-5-ylmethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 64524391 |
| Molecular Formula | C9H10ClN7O |
| Molecular Weight | 267.68 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 3-chloro-6-hydrazinyl-N-(1H-1,2,4-triazol-5-ylmethyl)pyridine-2-carboxamide |
| SMILES | NNc1ccc(Cl)c(C(=O)NCc2ncn[nH]2)n1 |
| InChI | InChI=1S/C9H10ClN7O/c10-5-1-2-6(16-11)15-8(5)9(18)12-3-7-13-4-14-17-7/h1-2,4H,3,11H2,(H,12,18)(H,15,16)(H,13,14,17) |
| InChIKey | CMNYHDNLJYGWGZ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.68 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|