C8H8ClF3N4O — CID 62235822
3-chloro-6-hydrazinyl-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide (PubChem CID 62235822) has the molecular formula C8H8ClF3N4O and a molecular weight of 268.63 g/mol. Its IUPAC name is 3-chloro-6-hydrazinyl-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide.
| Compound Name | 3-chloro-6-hydrazinyl-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 62235822 |
| Molecular Formula | C8H8ClF3N4O |
| Molecular Weight | 268.63 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 3-chloro-6-hydrazinyl-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide |
| SMILES | NNc1ccc(Cl)c(C(=O)NCC(F)(F)F)n1 |
| InChI | InChI=1S/C8H8ClF3N4O/c9-4-1-2-5(16-13)15-6(4)7(17)14-3-8(10,11)12/h1-2H,3,13H2,(H,14,17)(H,15,16) |
| InChIKey | JBQGLTUNNIRSDV-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.63 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|